![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|---|
|
|---|
![[DIR]](/icons/back.gif) | Parent Directory | | - | |
![[IMG]](/icons/image2.gif) | Adding Rational Numbers.png | 19-Sep-2024 09:15 | 721 | |
| Adding and Subtracting Complex Numbers.png | 19-Sep-2024 09:15 | 1.0K | |
| Adding and Subtracting Decimals.png | 19-Sep-2024 09:15 | 682 | |
| Adding and Subtracting Fractions.png | 19-Sep-2024 09:15 | 1.0K | |
| Adding and Subtracting Integers.png | 19-Sep-2024 09:15 | 701 | |
| Adding and Subtracting Matrices.png | 19-Sep-2024 09:15 | 1.9K | |
| Adding and Subtracting Polynomials.png | 19-Sep-2024 09:15 | 1.2K | |
| Adding and Subtracting Radicals.png | 19-Sep-2024 09:15 | 1.4K | |
| Adding and Subtracting Rational Expressions.png | 19-Sep-2024 09:15 | 1.7K | |
| Adding and Subtracting Rational Fractions.png | 19-Sep-2024 09:15 | 1.6K | |
| Addition and Subtraction.png | 19-Sep-2024 09:15 | 1.2K | |
| Algebraic Applications of Matrices.png | 19-Sep-2024 09:15 | 2.6K | |
| Angle Measures and Side Length of Quadrilaterals.png | 19-Sep-2024 09:15 | 4.1K | |
| Angle Measures and Side Lengths of Polygons.png | 19-Sep-2024 09:15 | 1.7K | |
| Angles and Side Lengths of Triangles.png | 19-Sep-2024 09:15 | 2.4K | |
| Angles and Their Measures.png | 19-Sep-2024 09:15 | 1.8K | |
| Applying Similarity.png | 19-Sep-2024 09:15 | 2.9K | |
| Arcs.png | 19-Sep-2024 09:15 | 4.1K | |
| Area.png | 19-Sep-2024 09:15 | 2.5K | |
| Area Probabilities.png | 19-Sep-2024 09:15 | 5.1K | |
| Area of a Polygon.png | 19-Sep-2024 09:15 | 2.1K | |
| Areas Under Any Normal Curve.png | 19-Sep-2024 09:15 | 4.2K | |
| Areas Under the Standard Normal Distribution.png | 19-Sep-2024 09:15 | 2.0K | |
| Areas of Sectors and Regions.png | 19-Sep-2024 09:15 | 6.0K | |
| Arithmetic Sequences and Series.png | 19-Sep-2024 09:15 | 2.0K | |
| Bar Graphs.png | 19-Sep-2024 09:15 | 3.8K | |
| Binomial Distributions.png | 19-Sep-2024 09:15 | 8.6K | |
| Box-and-Whisker Plots.png | 19-Sep-2024 09:15 | 1.7K | |
| Central Limit Theorem.png | 19-Sep-2024 09:15 | 4.7K | |
| Characteristics of Polygons.png | 19-Sep-2024 09:15 | 2.0K | |
| Choosing a Strategy for Solving a Quadratic Equation.png | 19-Sep-2024 09:15 | 3.1K | |
| Circle Graphs.png | 19-Sep-2024 09:15 | 6.4K | |
| Classifying Types of Quadrilaterals.png | 19-Sep-2024 09:15 | 2.4K | |
| Combining Like Terms.png | 19-Sep-2024 09:15 | 1.3K | |
| Common Denominators.png | 19-Sep-2024 09:15 | 1.9K | |
| Common Factors (Monomials and Binomials).png | 19-Sep-2024 09:15 | 1.1K | |
| Common Factors (Polynomials).png | 19-Sep-2024 09:15 | 1.6K | |
| Common Multiples (Monomials).png | 19-Sep-2024 09:15 | 1.2K | |
| Common Multiples (Monomials and Binomials).png | 19-Sep-2024 09:15 | 1.1K | |
| Common Multiples (Numbers).png | 19-Sep-2024 09:15 | 1.3K | |
| Comparing Areas and Perimeters.png | 19-Sep-2024 09:15 | 2.4K | |
| Comparing Equations and Graphs.png | 19-Sep-2024 09:15 | 2.8K | |
| Comparing Exponential Equations to Other Equations.png | 19-Sep-2024 09:15 | 949 | |
| Comparing Exponential Growth and Exponential Decay.png | 19-Sep-2024 09:15 | 13K | |
| Comparing Fractions and Decimals.png | 19-Sep-2024 09:15 | 1.5K | |
| Comparing Functions and Relations.png | 19-Sep-2024 09:15 | 1.4K | |
| Comparing Graphs of Quadratic Functions.png | 19-Sep-2024 09:15 | 24K | |
| Comparing Linear and Exponential Data.png | 19-Sep-2024 09:15 | 2.9K | |
| Comparing Quadratic Functions to Other Functions.png | 19-Sep-2024 09:15 | 2.4K | |
| Comparing Rates.png | 19-Sep-2024 09:15 | 3.2K | |
| Comparing Rational Numbers.png | 19-Sep-2024 09:15 | 1.7K | |
| Comparing and Ordering Integers.png | 19-Sep-2024 09:15 | 1.4K | |
| Comparing and Ordering Rational Numbers.png | 19-Sep-2024 09:15 | 1.0K | |
| Comparing and Ordering Whole Numbers.png | 19-Sep-2024 09:15 | 2.3K | |
| Composition of Functions.png | 19-Sep-2024 09:15 | 1.3K | |
| Compound Events.png | 19-Sep-2024 09:15 | 2.5K | |
| Confidence Intervals.png | 19-Sep-2024 09:15 | 1.9K | |
| Connecting Quadratic Equations and Graphs.png | 19-Sep-2024 09:15 | 3.0K | |
| Consecutive Number Problems.png | 19-Sep-2024 09:15 | 2.1K | |
| Converting Rates.png | 19-Sep-2024 09:15 | 1.4K | |
| Coordinate Proofs.png | 19-Sep-2024 09:15 | 3.7K | |
| Correlation and Regression.png | 19-Sep-2024 09:15 | 4.0K | |
| Cross Sections.png | 19-Sep-2024 09:15 | 3.0K | |
| Degree and Radian Measures.png | 19-Sep-2024 09:15 | 1.4K | |
| Describing Graphs of Polynomial Functions.png | 19-Sep-2024 09:15 | 22K | |
| Describing Graphs of Quadratic Functions.png | 19-Sep-2024 09:15 | 2.8K | |
| Determining Similarity.png | 19-Sep-2024 09:15 | 2.1K | |
| Determining Whether Lines are Parallel or Perpendicular.png | 19-Sep-2024 09:15 | 1.8K | |
| Diagonals of Quadrilaterals.png | 19-Sep-2024 09:15 | 5.3K | |
| Difference of Two Means.png | 19-Sep-2024 09:15 | 4.2K | |
| Difference of Two Proportions.png | 19-Sep-2024 09:15 | 3.1K | |
| Dilations.png | 19-Sep-2024 09:15 | 2.4K | |
| Direct Variation.png | 19-Sep-2024 09:15 | 2.2K | |
| Direction of a Vector.png | 19-Sep-2024 09:15 | 1.7K | |
| Displaying Data.png | 19-Sep-2024 09:15 | 3.3K | |
| Dividing Polynomials.png | 19-Sep-2024 09:15 | 1.5K | |
| Dividing Polynomials by Binomials.png | 19-Sep-2024 09:15 | 902 | |
| Dividing Radicals.png | 19-Sep-2024 09:15 | 2.2K | |
| Dividing Rational Expressions.png | 19-Sep-2024 09:15 | 922 | |
| Dividing Rational Numbers.png | 19-Sep-2024 09:15 | 836 | |
| Domain and Range.png | 19-Sep-2024 09:15 | 1.6K | |
| Double-Angle and Half-Angle Formulas.png | 19-Sep-2024 09:15 | 1.8K | |
| Equations of Circles.png | 19-Sep-2024 09:15 | 1.6K | |
| Equations with Special Solutions.png | 19-Sep-2024 09:15 | 1.3K | |
| Estimating Decimal Products and Quotients.png | 19-Sep-2024 09:15 | 2.0K | |
| Estimating Decimal Sums and Differences.png | 19-Sep-2024 09:15 | 2.0K | |
| Estimating Probability in the Binomial Distribution.png | 19-Sep-2024 09:15 | 3.2K | |
| Estimating when Standard Deviation is Unknown.png | 19-Sep-2024 09:15 | 2.0K | |
| Euler's Rule.png | 19-Sep-2024 09:15 | 2.8K | |
| Evaluating Expressions.png | 19-Sep-2024 09:15 | 1.0K | |
| Evaluating Functions.png | 19-Sep-2024 09:15 | 1.7K | |
| Evaluating Reports Based on Data.png | 19-Sep-2024 09:15 | 2.8K | |
| Evaluating Trigonometric Functions of Any Angle.png | 19-Sep-2024 09:15 | 1.8K | |
| Factoring Cubic Polynomials.png | 19-Sep-2024 09:15 | 1.1K | |
| Factoring Monomials and Binomials.png | 19-Sep-2024 09:15 | 1.6K | |
| Factoring Polynomials.png | 19-Sep-2024 09:15 | 1.1K | |
| Factoring Polynomials of Higher Degree.png | 19-Sep-2024 09:15 | 1.4K | |
| Factoring Special Products.png | 19-Sep-2024 09:15 | 1.1K | |
| Factoring ax^2 + bx + c.png | 19-Sep-2024 09:15 | 1.2K | |
| Factoring x^2 + bx + c.png | 19-Sep-2024 09:15 | 1.2K | |
| Factors.png | 19-Sep-2024 09:15 | 846 | |
| Finding Areas and Perimeters of Similar Figures.png | 19-Sep-2024 09:15 | 3.7K | |
| Finding Equivalent Fractions and Decimals.png | 19-Sep-2024 09:15 | 1.4K | |
| Finding Probabilities.png | 19-Sep-2024 09:15 | 5.2K | |
| Frequency Tables.png | 19-Sep-2024 09:15 | 3.0K | |
| Function Operations.png | 19-Sep-2024 09:15 | 1.5K | |
| Geometric Applications of Matrices.png | 19-Sep-2024 09:15 | 2.1K | |
| Geometric Sequences and Series.png | 19-Sep-2024 09:15 | 1.7K | |
| Glide Translations.png | 19-Sep-2024 09:15 | 3.2K | |
| Goodness of Fit (Chi-Square).png | 19-Sep-2024 09:15 | 1.7K | |
| Graphing Absolute Value Functions.png | 19-Sep-2024 09:15 | 2.1K | |
| Graphing Circles.png | 19-Sep-2024 09:15 | 1.0K | |
| Graphing Complex Numbers.png | 19-Sep-2024 09:15 | 1.6K | |
| Graphing Complex Numbers in Polar Form.png | 19-Sep-2024 09:15 | 1.8K | |
| Graphing Inequalities on a Number Line.png | 19-Sep-2024 09:15 | 1.7K | |
| Graphing Linear Inequalities.png | 19-Sep-2024 09:15 | 1.0K | |
| Graphing Quadratic Functions Using Key Features.png | 19-Sep-2024 09:15 | 2.4K | |
| Graphing Sine and Cosine Functions.png | 19-Sep-2024 09:15 | 1.7K | |
| Graphing Square Root Functions.png | 19-Sep-2024 09:15 | 8.8K | |
| Graphing Tangent Functions.png | 19-Sep-2024 09:15 | 1.7K | |
| Graphing a Rational Function.png | 19-Sep-2024 09:15 | 1.3K | |
| Graphing a System of Linear Equations.png | 19-Sep-2024 09:15 | 1.6K | |
| Graphing a System of Linear Inequalities.png | 19-Sep-2024 09:15 | 1.8K | |
| Graphing by Transformations.png | 19-Sep-2024 09:15 | 2.0K | |
| Graphs of Normal Probability Distributions.png | 19-Sep-2024 09:15 | 3.1K | |
| Greatest Common Factors (Monomials and Binomials).png | 19-Sep-2024 09:15 | 1.6K | |
| Greatest Common Factors.png | 19-Sep-2024 09:15 | 1.6K | |
| Histograms.png | 19-Sep-2024 09:15 | 2.8K | |
| Horizontal Lines.png | 19-Sep-2024 09:15 | 1.1K | |
| Identifying Angle Pair Relationships.png | 19-Sep-2024 09:15 | 2.8K | |
| Identifying Congruent Triangles.png | 19-Sep-2024 09:15 | 4.3K | |
| Identifying Rational Numbers.png | 19-Sep-2024 09:15 | 913 | |
| Identifying Slope and y-intercept.png | 19-Sep-2024 09:15 | 847 | |
| Identifying and Classifying Triangles.png | 19-Sep-2024 09:15 | 3.0K | |
| Identifying and Evaluating Special Products.png | 19-Sep-2024 09:15 | 1.8K | |
| Identifying and Simplifying Special Products.png | 19-Sep-2024 09:15 | 1.9K | |
| Identifying and Writing Numbers in Scientific Notation.png | 19-Sep-2024 09:15 | 1.2K | |
| Infinite Geometric Series.png | 19-Sep-2024 09:15 | 1.6K | |
| Integers and Absolute Value.png | 19-Sep-2024 09:15 | 885 | |
| Introduction to Matrices.png | 19-Sep-2024 09:15 | 2.6K | |
| Introduction to Sequences and Series.png | 19-Sep-2024 09:15 | 1.8K | |
| Inverse Functions.png | 19-Sep-2024 09:15 | 1.2K | |
| Inverse Trigonometric Functions.png | 19-Sep-2024 09:15 | 3.4K | |
| Inverse Variation.png | 19-Sep-2024 09:15 | 2.0K | |
| Irrational and Real Numbers.png | 19-Sep-2024 09:15 | 2.0K | |
| Isometries.png | 19-Sep-2024 09:15 | 2.1K | |
| Law of Cosines.png | 19-Sep-2024 09:15 | 2.8K | |
| Law of Sines.png | 19-Sep-2024 09:15 | 2.5K | |
| Lengths and Angle Measures.png | 19-Sep-2024 09:15 | 2.4K | |
| Line Graphs.png | 19-Sep-2024 09:15 | 2.5K | |
| Linear Correlation.png | 19-Sep-2024 09:15 | 3.2K | |
| Linear Equations.png | 19-Sep-2024 09:15 | 1.9K | |
| Linear Functions, Writing.png | 19-Sep-2024 09:15 | 2.4K | |
| Linear Regression.png | 19-Sep-2024 09:15 | 1.9K | |
| Logarithmic Equations and Graphs.png | 19-Sep-2024 09:15 | 2.5K | |
| Magnitude of a Vector.png | 19-Sep-2024 09:15 | 1.1K | |
| Making and Using a Table of Values.png | 19-Sep-2024 09:15 | 1.8K | |
| Mathematical Properties.png | 19-Sep-2024 09:15 | 2.0K | |
| Matrix Inverses.png | 19-Sep-2024 09:15 | 1.7K | |
| Matrix Multiplication.png | 19-Sep-2024 09:15 | 1.8K | |
| Measures of Central Tendency.png | 19-Sep-2024 09:15 | 2.0K | |
| Measures of Variation.png | 19-Sep-2024 09:15 | 3.5K | |
| Midsegments and Bisectors.png | 19-Sep-2024 09:15 | 3.1K | |
| Multiplication and Division.png | 19-Sep-2024 09:15 | 1.2K | |
| Multiplying Polynomials.png | 19-Sep-2024 09:15 | 1.4K | |
| Multiplying Positive and Negative Fractions.png | 19-Sep-2024 09:15 | 831 | |
| Multiplying Radical Expressions.png | 19-Sep-2024 09:15 | 2.4K | |
| Multiplying Radicals.png | 19-Sep-2024 09:15 | 1.7K | |
| Multiplying Rational Expressions.png | 19-Sep-2024 09:15 | 1.5K | |
| Multiplying Rational Numbers.png | 19-Sep-2024 09:15 | 784 | |
| Multiplying and Dividing Complex Numbers.png | 19-Sep-2024 09:15 | 1.0K | |
| Multiplying and Dividing Decimals.png | 19-Sep-2024 09:15 | 689 | |
| Multiplying and Dividing Fractions.png | 19-Sep-2024 09:15 | 1.1K | |
| Multiplying and Dividing Integers.png | 19-Sep-2024 09:15 | 747 | |
| Multiplying and Dividing Numbers in Scientific Notation.png | 19-Sep-2024 09:15 | 2.2K | |
| Multiplying and Dividing Rational Expressions.png | 19-Sep-2024 09:15 | 1.4K | |
| Negative and Zero Exponents.png | 19-Sep-2024 09:15 | 959 | |
| Normal Approximation to the Binomial Distribution.png | 19-Sep-2024 09:15 | 4.8K | |
| Numeric Patterns.png | 19-Sep-2024 09:15 | 1.8K | |
| Operations with Fractions.png | 19-Sep-2024 09:15 | 1.6K | |
| Operations with Integers.png | 19-Sep-2024 09:15 | 777 | |
| Operations with Monomials.png | 19-Sep-2024 09:15 | 1.4K | |
| Operations with Polynomials.png | 19-Sep-2024 09:15 | 1.3K | |
| Operations with Rational Expressions.png | 19-Sep-2024 09:15 | 1.4K | |
| Operations with Rational Numbers.png | 19-Sep-2024 09:15 | 676 | |
| Ordering Fractions.png | 19-Sep-2024 09:15 | 1.6K | |
| Order of Operations.png | 19-Sep-2024 09:15 | 2.0K | |
| Outcomes.png | 19-Sep-2024 09:15 | 3.6K | |
| Parallel and Perpendicular Lines.png | 19-Sep-2024 09:15 | 1.9K | |
| Parametric Equations.png | 19-Sep-2024 09:15 | 2.5K | |
| Percent Applications.png | 19-Sep-2024 09:15 | 2.0K | |
| Percent of Change.png | 19-Sep-2024 09:15 | 3.1K | |
| Perfect Squares.png | 19-Sep-2024 09:15 | 1.8K | |
| Perimeter.png | 19-Sep-2024 09:15 | 2.7K | |
| Permutations and Combinations.png | 19-Sep-2024 09:15 | 1.6K | |
| Place Value.png | 19-Sep-2024 09:15 | 1.4K | |
| Points, Lines and Planes.png | 19-Sep-2024 09:15 | 2.1K | |
| Polar Coordinates.png | 19-Sep-2024 09:15 | 4.6K | |
| Polynomial Functions and Their Graphs.png | 19-Sep-2024 09:15 | 5.0K | |
| Polynomial Remainder Theorem.png | 19-Sep-2024 09:15 | 2.3K | |
| Probabilities of Compound Events.png | 19-Sep-2024 09:15 | 4.2K | |
| Probabilities of Dependent Events.png | 19-Sep-2024 09:15 | 2.1K | |
| Probabilities of Independent Events.png | 19-Sep-2024 09:15 | 2.6K | |
| Properties of Logarithms.png | 19-Sep-2024 09:15 | 2.0K | |
| Properties of Matrix Multiplication.png | 19-Sep-2024 09:15 | 3.0K | |
| Properties of Real Numbers.png | 19-Sep-2024 09:15 | 2.4K | |
| Proving Triangles Congruent.png | 19-Sep-2024 09:15 | 2.9K | |
| Pythagorean Triples.png | 19-Sep-2024 09:15 | 2.6K | |
| Rates and Unit Rates.png | 19-Sep-2024 09:15 | 3.5K | |
| Rational Exponents.png | 19-Sep-2024 09:15 | 1.7K | |
| Reasoning and Logic.png | 19-Sep-2024 09:15 | 3.6K | |
| Reciprocals.png | 19-Sep-2024 09:15 | 824 | |
| Reflections.png | 19-Sep-2024 09:15 | 2.3K | |
| Right Triangle Trigonometry.png | 19-Sep-2024 09:15 | 2.2K | |
| Rotations.png | 19-Sep-2024 09:15 | 4.0K | |
| Rules of Exponents.png | 19-Sep-2024 09:15 | 1.1K | |
| Sample Questions.png | 19-Sep-2024 09:15 | 4.1K | |
| Sampling Distributions.png | 19-Sep-2024 09:15 | 4.9K | |
| Sampling Techniques.png | 19-Sep-2024 09:15 | 4.4K | |
| Scalar Multiples of Vectors.png | 19-Sep-2024 09:15 | 1.2K | |
| Scalar Multiplication of Matrices.png | 19-Sep-2024 09:15 | 2.0K | |
| Scatter Plots.png | 19-Sep-2024 09:15 | 1.2K | |
| Scatter Plots and Correlation.png | 19-Sep-2024 09:15 | 2.1K | |
| Segment Probabilities.png | 19-Sep-2024 09:15 | 2.3K | |
| Similar Solids.png | 19-Sep-2024 09:15 | 2.5K | |
| Similarity and Scale Models.png | 19-Sep-2024 09:15 | 2.3K | |
| Simplifying Complex Numbers.png | 19-Sep-2024 09:15 | 1.2K | |
| Simplifying Expressions with Exponents.png | 19-Sep-2024 09:15 | 1.0K | |
| Simplifying Fractions with Radicals.png | 19-Sep-2024 09:15 | 1.5K | |
| Simplifying Radical Expressions.png | 19-Sep-2024 09:15 | 2.4K | |
| Simplifying Rational Expressions Using Common Factors.png | 19-Sep-2024 09:15 | 1.1K | |
| Simplifying and Evaluating Logarithms.png | 19-Sep-2024 09:15 | 3.2K | |
| Solid Figures.png | 19-Sep-2024 09:15 | 4.9K | |
| Solve Special Types of Linear Systems.png | 19-Sep-2024 09:15 | 3.8K | |
| Solve a System of Linear Equations.png | 19-Sep-2024 09:15 | 1.3K | |
| Solve a System of Linear Equations Using Multiplication.png | 19-Sep-2024 09:15 | 3.0K | |
| Solve a System of Linear Equations by Adding or Subtracting.png | 19-Sep-2024 09:15 | 1.7K | |
| Solving Absolute Value Equations and Inequalities.png | 19-Sep-2024 09:15 | 794 | |
| Solving Compound Inequalities.png | 19-Sep-2024 09:15 | 1.6K | |
| Solving Equations and Formulas.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving Equations with Decimals.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving Equations with Fractions.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving Equations with Fractions and Decimals.png | 19-Sep-2024 09:15 | 865 | |
| Solving Equations with Rational Numbers.png | 19-Sep-2024 09:15 | 3.8K | |
| Solving Equations with Variables on Both Sides.png | 19-Sep-2024 09:15 | 1.6K | |
| Solving Exponential Equations.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving Exponential and Logarithmic Equations (Cumulative).png | 19-Sep-2024 09:15 | 3.3K | |
| Solving Inequalities.png | 19-Sep-2024 09:15 | 962 | |
| Solving Inequalities with Decimals.png | 19-Sep-2024 09:15 | 4.0K | |
| Solving Inequalities with Fractions.png | 19-Sep-2024 09:15 | 2.2K | |
| Solving Linear Inequalities.png | 19-Sep-2024 09:15 | 2.0K | |
| Solving Logarithmic Equations.png | 19-Sep-2024 09:15 | 3.1K | |
| Solving Multi-Step Equations.png | 19-Sep-2024 09:15 | 1.9K | |
| Solving Multi-Step Radical Equations.png | 19-Sep-2024 09:15 | 1.2K | |
| Solving Multi-Step Rational Equations.png | 19-Sep-2024 09:15 | 1.2K | |
| Solving One-Step Equations.png | 19-Sep-2024 09:15 | 1.6K | |
| Solving Percent Problems.png | 19-Sep-2024 09:15 | 1.0K | |
| Solving Polynomial Equations.png | 19-Sep-2024 09:15 | 1.0K | |
| Solving Polynomial Equations Using ax^2 + bx + c.png | 19-Sep-2024 09:15 | 2.5K | |
| Solving Polynomial Equations Using x^2 + bx + c.png | 19-Sep-2024 09:15 | 2.6K | |
| Solving Problems with Vectors.png | 19-Sep-2024 09:15 | 2.5K | |
| Solving Proportions.png | 19-Sep-2024 09:15 | 1.0K | |
| Solving Quadratic Equations Using the Quadratic Formula.png | 19-Sep-2024 09:15 | 1.3K | |
| Solving Quadratic Equations by Completing the Square.png | 19-Sep-2024 09:15 | 1.4K | |
| Solving Quadratic Equations by Factoring.png | 19-Sep-2024 09:15 | 1.0K | |
| Solving Quadratic Equations by Graphing.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving Trigonometric Equations.png | 19-Sep-2024 09:15 | 1.6K | |
| Solving Two-Step Equations.png | 19-Sep-2024 09:15 | 1.3K | |
| Solving Two-Step Radical Equations.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving a Linear Equation by Graphing.png | 19-Sep-2024 09:15 | 1.1K | |
| Solving a Quadratic Equation.png | 19-Sep-2024 09:15 | 7.2K | |
| Special Quadrilaterals.png | 19-Sep-2024 09:15 | 4.3K | |
| Special Triangles.png | 19-Sep-2024 09:15 | 2.6K | |
| Square Roots.png | 19-Sep-2024 09:15 | 870 | |
| Square and Cube Roots.png | 19-Sep-2024 09:15 | 1.6K | |
| Statistical Tests.png | 19-Sep-2024 09:15 | 3.1K | |
| Strategies for Comparing Fractions.png | 19-Sep-2024 09:15 | 1.3K | |
| Strategies for Comparing Rational Numbers.png | 19-Sep-2024 09:15 | 1.6K | |
| Strategies for Dividing a Polynomial by a Monomial.png | 19-Sep-2024 09:15 | 1.4K | |
| Strategies for Factoring ax^2 + bx + c.png | 19-Sep-2024 09:15 | 1.2K | |
| Strategies for Factoring x^2 + bx + c .png | 19-Sep-2024 09:15 | 1.3K | |
| Strategies for Factoring x^2 + bx + c.png | 19-Sep-2024 09:15 | 1.7K | |
| Strategies for Multiplying Radical Expressions.png | 19-Sep-2024 09:15 | 2.3K | |
| Subtracting Rational Numbers.png | 19-Sep-2024 09:15 | 906 | |
| Surface Area.png | 19-Sep-2024 09:15 | 1.6K | |
| Symmetry.png | 19-Sep-2024 09:15 | 2.3K | |
| Systems of Linear Inequalities.png | 19-Sep-2024 09:15 | 3.5K | |
| Tesselations.png | 19-Sep-2024 09:15 | 2.9K | |
| Tessellations.png | 19-Sep-2024 09:15 | 5.3K | |
| Testing Variance and Standard Deviation.png | 19-Sep-2024 09:15 | 3.3K | |
| Testing a Proportion.png | 19-Sep-2024 09:15 | 3.0K | |
| Testing the Mean.png | 19-Sep-2024 09:15 | 2.4K | |
| Tests Involving Dependent Samples.png | 19-Sep-2024 09:15 | 5.5K | |
| Tests of Independence (Chi-Square).png | 19-Sep-2024 09:15 | 4.8K | |
| The Binomial Theorem and Pascal's Triangle.png | 19-Sep-2024 09:15 | 2.4K | |
| The Coordinate Plane.png | 19-Sep-2024 09:15 | 9.1K | |
| The Counting Principle and Outcomes.png | 19-Sep-2024 09:15 | 2.7K | |
| The Fundamental Theorem of Algebra.png | 19-Sep-2024 09:15 | 3.4K | |
| The Number Pi.png | 19-Sep-2024 09:15 | 2.1K | |
| The Number e.png | 19-Sep-2024 09:15 | 2.6K | |
| The Slope of a Line.png | 19-Sep-2024 09:15 | 3.0K | |
| Tools for Statistics.png | 19-Sep-2024 09:15 | 2.2K | |
| Transformations.png | 19-Sep-2024 09:15 | 1.8K | |
| Translating and Reflecting Trigonometric Graphs.png | 19-Sep-2024 09:15 | 1.9K | |
| Translating from One Form to Another.png | 19-Sep-2024 09:15 | 1.6K | |
| Translations.png | 19-Sep-2024 09:15 | 2.5K | |
| Trigonometric Identities.png | 19-Sep-2024 09:15 | 1.3K | |
| Two-Way Frequency Tables.png | 19-Sep-2024 09:15 | 4.3K | |
| Understanding Circles.png | 19-Sep-2024 09:15 | 1.4K | |
| Understanding Congruence.png | 19-Sep-2024 09:15 | 2.4K | |
| Unit Rates.png | 19-Sep-2024 09:15 | 1.3K | |
| Units.png | 19-Sep-2024 09:15 | 1.1K | |
| Use an Equation to Graph a Linear Function.png | 19-Sep-2024 09:15 | 28K | |
| Using Angle Measures and Side Lengths.png | 19-Sep-2024 09:15 | 2.4K | |
| Using Angle Pair Relationships.png | 19-Sep-2024 09:15 | 2.8K | |
| Using Equations to Model Data.png | 19-Sep-2024 09:15 | 6.0K | |
| Using Probability to Evaluate Real World Data.png | 19-Sep-2024 09:15 | 5.1K | |
| Using Probability to Make Fair Decisions.png | 19-Sep-2024 09:15 | 2.9K | |
| Using Scale Factors with Similar Figures.png | 19-Sep-2024 09:15 | 2.3K | |
| Using Similarity to Determine Unknown Measures.png | 19-Sep-2024 09:15 | 1.9K | |
| Using Square Roots to Solve Quadratic Equations.png | 19-Sep-2024 09:15 | 1.3K | |
| Using Sum and Difference Formulas.png | 19-Sep-2024 09:15 | 2.5K | |
| Using Trigonometry to Find Area and Perimeter.png | 19-Sep-2024 09:15 | 3.2K | |
| Using Trigonometry to Find Area and Perimeter.png | 19-Sep-2024 09:15 | 2.3K | |
| Using a Table of Values.png | 19-Sep-2024 09:15 | 1.9K | |
| Using the Converse of the Pythagorean Theorem.png | 19-Sep-2024 09:15 | 1.8K | |
| Using the Discriminant.png | 19-Sep-2024 09:15 | 2.1K | |
| Using the Pythagorean Theorem.png | 19-Sep-2024 09:15 | 1.5K | |
| Using the Pythagorean Theorem to Find Distance between Two Points.png | 19-Sep-2024 09:15 | 3.6K | |
| Vector Sums.png | 19-Sep-2024 09:15 | 1.7K | |
| Vertical Lines.png | 19-Sep-2024 09:15 | 1.2K | |
| Volume.png | 19-Sep-2024 09:15 | 2.2K | |
| Working with Exponents.png | 19-Sep-2024 09:15 | 1.6K | |
| Write and Solve a System of Linear Equations.png | 19-Sep-2024 09:15 | 1.5K | |
| Writing Decimals as Fractions.png | 19-Sep-2024 09:15 | 1.1K | |
| Writing Equations in Slope-Intercept Form.png | 19-Sep-2024 09:15 | 2.9K | |
| Writing Equations of Parallel and Perpendicular Lines.png | 19-Sep-2024 09:15 | 2.1K | |
| Writing Expressions.png | 19-Sep-2024 09:15 | 1.2K | |
| Writing Fractions as Decimals.png | 19-Sep-2024 09:15 | 852 | |
| Writing Fractions in Simplest Form.png | 19-Sep-2024 09:15 | 1.0K | |
| Writing Fractions or Decimals as Percents.png | 19-Sep-2024 09:15 | 1.1K | |
| Writing Inequalities.png | 19-Sep-2024 09:15 | 1.6K | |
| Writing Integers as Fractions.png | 19-Sep-2024 09:15 | 962 | |
| Writing Linear Equations in Point-Slope Form.png | 19-Sep-2024 09:15 | 1.8K | |
| Writing Linear Equations in Standard Form.png | 19-Sep-2024 09:15 | 1.6K | |
| Writing Percents as Fractions or Decimals.png | 19-Sep-2024 09:15 | 2.1K | |
| Writing Proofs.png | 19-Sep-2024 09:15 | 2.6K | |
| Writing Proportions.png | 19-Sep-2024 09:15 | 3.9K | |
| Writing Quadratic Functions from a Graph.png | 19-Sep-2024 09:15 | 2.4K | |
| Writing Rates.png | 19-Sep-2024 09:15 | 1.1K | |
| Writing Statements.png | 19-Sep-2024 09:15 | 2.0K | |
| Writing a Linear Equation.png | 19-Sep-2024 09:15 | 1.9K | |
| Writing and Comparing Ratios.png | 19-Sep-2024 09:15 | 1.4K | |
| Writing and Graphing Exponential Decay Functions.png | 19-Sep-2024 09:15 | 15K | |
| Writing and Graphing Exponential Growth Functions.png | 19-Sep-2024 09:15 | 32K | |
| Writing and Naming Decimals.png | 19-Sep-2024 09:15 | 1.7K | |
| Writing and Naming Polynomials.png | 19-Sep-2024 09:15 | 1.7K | |
| X- and y-intercepts.png | 19-Sep-2024 09:15 | 1.3K | |
| nth Roots and Rational Exponents.png | 19-Sep-2024 09:15 | 1.7K | |
|
|---|
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
.png){kind=link}
